C17H18O2S — CID 134916963
bis(2,4-dimethylphenoxy)methanethione (PubChem CID 134916963) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is bis(2,4-dimethylphenoxy)methanethione.
| Compound Name | bis(2,4-dimethylphenoxy)methanethione |
|---|---|
| PubChem CID | 134916963 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | bis(2,4-dimethylphenoxy)methanethione |
| SMILES | Cc1ccc(OC(=S)Oc2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C17H18O2S/c1-11-5-7-15(13(3)9-11)18-17(20)19-16-8-6-12(2)10-14(16)4/h5-10H,1-4H3 |
| InChIKey | ZMTLJQQLRKUSAA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|