C12H20O — CID 54037455
1-methoxy-2,4-dimethylbenzene;propane (PubChem CID 54037455) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-methoxy-2,4-dimethylbenzene;propane.
| Compound Name | 1-methoxy-2,4-dimethylbenzene;propane |
|---|---|
| PubChem CID | 54037455 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-methoxy-2,4-dimethylbenzene;propane |
| SMILES | CCC.COc1ccc(C)cc1C |
| InChI | InChI=1S/C9H12O.C3H8/c1-7-4-5-9(10-3)8(2)6-7;1-3-2/h4-6H,1-3H3;3H2,1-2H3 |
| InChIKey | LJYVZBFYHIYZOQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |