C13H20O3 — CID 174810221
ethyl acetate;1-methoxy-2,4-dimethylbenzene (PubChem CID 174810221) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethyl acetate;1-methoxy-2,4-dimethylbenzene.
| Compound Name | ethyl acetate;1-methoxy-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 174810221 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | ethyl acetate;1-methoxy-2,4-dimethylbenzene |
| SMILES | CCOC(C)=O.COc1ccc(C)cc1C |
| InChI | InChI=1S/C9H12O.C4H8O2/c1-7-4-5-9(10-3)8(2)6-7;1-3-6-4(2)5/h4-6H,1-3H3;3H2,1-2H3 |
| InChIKey | VABIWKKHEGZKSC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |