C15H22O4 — CID 62393496
ethyl 2-[hydroxy-(4-methoxy-3-methylphenyl)methyl]butanoate (PubChem CID 62393496) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl 2-[hydroxy-(4-methoxy-3-methylphenyl)methyl]butanoate.
| Compound Name | ethyl 2-[hydroxy-(4-methoxy-3-methylphenyl)methyl]butanoate |
|---|---|
| PubChem CID | 62393496 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl 2-[hydroxy-(4-methoxy-3-methylphenyl)methyl]butanoate |
| SMILES | CCOC(=O)C(CC)C(O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C15H22O4/c1-5-12(15(17)19-6-2)14(16)11-7-8-13(18-4)10(3)9-11/h7-9,12,14,16H,5-6H2,1-4H3 |
| InChIKey | CIUZMRNTQQLDKQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |