C16H24O4 — CID 66338003
tert-butyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-2-methylpropanoate (PubChem CID 66338003) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-2-methylpropanoate.
| Compound Name | tert-butyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 66338003 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(4-methoxy-3-methylphenyl)-2-methylpropanoate |
| SMILES | COc1ccc(C(O)C(C)C(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C16H24O4/c1-10-9-12(7-8-13(10)19-6)14(17)11(2)15(18)20-16(3,4)5/h7-9,11,14,17H,1-6H3 |
| InChIKey | VEZOIBGWAXKQCN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |