C15H21FO3 — CID 66337808
tert-butyl 3-(3-fluoro-4-methylphenyl)-3-hydroxy-2-methylpropanoate (PubChem CID 66337808) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is tert-butyl 3-(3-fluoro-4-methylphenyl)-3-hydroxy-2-methylpropanoate.
| Compound Name | tert-butyl 3-(3-fluoro-4-methylphenyl)-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 66337808 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | tert-butyl 3-(3-fluoro-4-methylphenyl)-3-hydroxy-2-methylpropanoate |
| SMILES | Cc1ccc(C(O)C(C)C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H21FO3/c1-9-6-7-11(8-12(9)16)13(17)10(2)14(18)19-15(3,4)5/h6-8,10,13,17H,1-5H3 |
| InChIKey | JKBWKAYXLXSVAJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |