C18H29FN2O2 — CID 103788216
tert-butyl N-[1-[1-(3-fluoro-4-methylphenyl)ethylamino]-2-methylpropan-2-yl]carbamate (PubChem CID 103788216) has the molecular formula C18H29FN2O2 and a molecular weight of 324.44 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(3-fluoro-4-methylphenyl)ethylamino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(3-fluoro-4-methylphenyl)ethylamino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 103788216 |
| Molecular Formula | C18H29FN2O2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | tert-butyl N-[1-[1-(3-fluoro-4-methylphenyl)ethylamino]-2-methylpropan-2-yl]carbamate |
| SMILES | Cc1ccc(C(C)NCC(C)(C)NC(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C18H29FN2O2/c1-12-8-9-14(10-15(12)19)13(2)20-11-18(6,7)21-16(22)23-17(3,4)5/h8-10,13,20H,11H2,1-7H3,(H,21,22) |
| InChIKey | UOYRNSJKXWMAIO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |