C15H22F2N2O2 — CID 124575856
tert-butyl N-[2-[[(1S)-1-(3,4-difluorophenyl)ethyl]amino]ethyl]carbamate (PubChem CID 124575856) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1S)-1-(3,4-difluorophenyl)ethyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1S)-1-(3,4-difluorophenyl)ethyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 124575856 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | tert-butyl N-[2-[[(1S)-1-(3,4-difluorophenyl)ethyl]amino]ethyl]carbamate |
| SMILES | C[C@H](NCCNC(=O)OC(C)(C)C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2O2/c1-10(11-5-6-12(16)13(17)9-11)18-7-8-19-14(20)21-15(2,3)4/h5-6,9-10,18H,7-8H2,1-4H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | YSPHZPBNMBIAFU-JTQLQIEISA-N |
| XLogP | 3.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|