C15H24N2O4 — CID 107711346
tert-butyl N-[2-[1-(2,6-dihydroxyphenyl)ethylamino]ethyl]carbamate (PubChem CID 107711346) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2,6-dihydroxyphenyl)ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2,6-dihydroxyphenyl)ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 107711346 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | tert-butyl N-[2-[1-(2,6-dihydroxyphenyl)ethylamino]ethyl]carbamate |
| SMILES | CC(NCCNC(=O)OC(C)(C)C)c1c(O)cccc1O |
| InChI | InChI=1S/C15H24N2O4/c1-10(13-11(18)6-5-7-12(13)19)16-8-9-17-14(20)21-15(2,3)4/h5-7,10,16,18-19H,8-9H2,1-4H3,(H,17,20) |
| InChIKey | VHAJRICWAPMBLX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|