C20H40N4O6 — CID 131048509
tert-butyl N-[2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]ethyl]carbamate (PubChem CID 131048509) has the molecular formula C20H40N4O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is tert-butyl N-[2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 131048509 |
| Molecular Formula | C20H40N4O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | tert-butyl N-[2-[1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-ylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(CNC(=O)OC(C)(C)C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N4O6/c1-18(2,3)28-15(25)22-11-10-21-14(12-23-16(26)29-19(4,5)6)13-24-17(27)30-20(7,8)9/h14,21H,10-13H2,1-9H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | UQVWOMFZSGNABD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|