C11H24N2O2 — CID 103386965
tert-butyl N-[2-(propan-2-ylamino)propyl]carbamate (PubChem CID 103386965) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is tert-butyl N-[2-(propan-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(propan-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 103386965 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | tert-butyl N-[2-(propan-2-ylamino)propyl]carbamate |
| SMILES | CC(C)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-8(2)13-9(3)7-12-10(14)15-11(4,5)6/h8-9,13H,7H2,1-6H3,(H,12,14) |
| InChIKey | LWVDQDWSFUBGJQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |