C12H26N2O3 — CID 103391216
tert-butyl N-[2-[[(2S)-1-hydroxybutan-2-yl]amino]propyl]carbamate (PubChem CID 103391216) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S)-1-hydroxybutan-2-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2S)-1-hydroxybutan-2-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103391216 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | tert-butyl N-[2-[[(2S)-1-hydroxybutan-2-yl]amino]propyl]carbamate |
| SMILES | CC[C@@H](CO)NC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H26N2O3/c1-6-10(8-15)14-9(2)7-13-11(16)17-12(3,4)5/h9-10,14-15H,6-8H2,1-5H3,(H,13,16)/t9?,10-/m0/s1 |
| InChIKey | STMOOGPMSVPRQS-AXDSSHIGSA-N |
| XLogP | 1.26 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |