C13H21ClN2O2S — CID 115607022
tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]ethyl]carbamate (PubChem CID 115607022) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 115607022 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]ethyl]carbamate |
| SMILES | CC(NCCNC(=O)OC(C)(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H21ClN2O2S/c1-9(10-5-6-11(14)19-10)15-7-8-16-12(17)18-13(2,3)4/h5-6,9,15H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | XIQKFYDWPBDZKL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|