C16H25ClN2O2S — CID 103785726
tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-cyclopropylethyl]carbamate (PubChem CID 103785726) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-cyclopropylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-cyclopropylethyl]carbamate |
|---|---|
| PubChem CID | 103785726 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | tert-butyl N-[2-[1-(5-chlorothiophen-2-yl)ethylamino]-2-cyclopropylethyl]carbamate |
| SMILES | CC(NC(CNC(=O)OC(C)(C)C)C1CC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H25ClN2O2S/c1-10(13-7-8-14(17)22-13)19-12(11-5-6-11)9-18-15(20)21-16(2,3)4/h7-8,10-12,19H,5-6,9H2,1-4H3,(H,18,20) |
| InChIKey | PECCLDMRXGKVAN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |