C17H29ClN2O2S — CID 107441541
tert-butyl N-[2-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate (PubChem CID 107441541) has the molecular formula C17H29ClN2O2S and a molecular weight of 360.95 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107441541 |
| Molecular Formula | C17H29ClN2O2S |
| Molecular Weight | 360.95 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | tert-butyl N-[2-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-3-methylbutyl]carbamate |
| SMILES | CC(NCC(CNC(=O)OC(C)(C)C)C(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H29ClN2O2S/c1-11(2)13(10-20-16(21)22-17(4,5)6)9-19-12(3)14-7-8-15(18)23-14/h7-8,11-13,19H,9-10H2,1-6H3,(H,20,21) |
| InChIKey | KAWXPXIOYBISEZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.95 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |