C13H21ClN2OS — CID 112688580
N-tert-butyl-3-[1-(5-chlorothiophen-2-yl)ethylamino]propanamide (PubChem CID 112688580) has the molecular formula C13H21ClN2OS and a molecular weight of 288.84 g/mol. Its IUPAC name is N-tert-butyl-3-[1-(5-chlorothiophen-2-yl)ethylamino]propanamide.
| Compound Name | N-tert-butyl-3-[1-(5-chlorothiophen-2-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 112688580 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-tert-butyl-3-[1-(5-chlorothiophen-2-yl)ethylamino]propanamide |
| SMILES | CC(NCCC(=O)NC(C)(C)C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H21ClN2OS/c1-9(10-5-6-11(14)18-10)15-8-7-12(17)16-13(2,3)4/h5-6,9,15H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | AOEIOVRBTZGRAE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |