C8H13ClN2O2S2 — CID 43551657
2-[1-(5-chlorothiophen-2-yl)ethylamino]ethanesulfonamide (PubChem CID 43551657) has the molecular formula C8H13ClN2O2S2 and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)ethylamino]ethanesulfonamide.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)ethylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 43551657 |
| Molecular Formula | C8H13ClN2O2S2 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)ethylamino]ethanesulfonamide |
| SMILES | CC(NCCS(N)(=O)=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2O2S2/c1-6(7-2-3-8(9)14-7)11-4-5-15(10,12)13/h2-3,6,11H,4-5H2,1H3,(H2,10,12,13) |
| InChIKey | KNSZVLVKYGIJBW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |