C10H17ClN2O2S2 — CID 106003944
4-amino-N-[1-(5-chlorothiophen-2-yl)ethyl]butane-1-sulfonamide (PubChem CID 106003944) has the molecular formula C10H17ClN2O2S2 and a molecular weight of 296.85 g/mol. Its IUPAC name is 4-amino-N-[1-(5-chlorothiophen-2-yl)ethyl]butane-1-sulfonamide.
| Compound Name | 4-amino-N-[1-(5-chlorothiophen-2-yl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 106003944 |
| Molecular Formula | C10H17ClN2O2S2 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-amino-N-[1-(5-chlorothiophen-2-yl)ethyl]butane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCCN)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H17ClN2O2S2/c1-8(9-4-5-10(11)16-9)13-17(14,15)7-3-2-6-12/h4-5,8,13H,2-3,6-7,12H2,1H3 |
| InChIKey | AAYKBARYLGPIPW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|