C8H13ClN2S — CID 60887972
N'-[1-(5-chlorothiophen-2-yl)ethyl]ethane-1,2-diamine (PubChem CID 60887972) has the molecular formula C8H13ClN2S and a molecular weight of 204.73 g/mol. Its IUPAC name is N'-[1-(5-chlorothiophen-2-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[1-(5-chlorothiophen-2-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60887972 |
| Molecular Formula | C8H13ClN2S |
| Molecular Weight | 204.73 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | N'-[1-(5-chlorothiophen-2-yl)ethyl]ethane-1,2-diamine |
| SMILES | CC(NCCN)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2S/c1-6(11-5-4-10)7-2-3-8(9)12-7/h2-3,6,11H,4-5,10H2,1H3 |
| InChIKey | ULUZMERZBUSTEH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.73 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |