C11H20N2O3S — CID 54958432
4-amino-N-[1-(5-methylfuran-2-yl)ethyl]butane-1-sulfonamide (PubChem CID 54958432) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-amino-N-[1-(5-methylfuran-2-yl)ethyl]butane-1-sulfonamide.
| Compound Name | 4-amino-N-[1-(5-methylfuran-2-yl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 54958432 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-amino-N-[1-(5-methylfuran-2-yl)ethyl]butane-1-sulfonamide |
| SMILES | Cc1ccc(C(C)NS(=O)(=O)CCCCN)o1 |
| InChI | InChI=1S/C11H20N2O3S/c1-9-5-6-11(16-9)10(2)13-17(14,15)8-4-3-7-12/h5-6,10,13H,3-4,7-8,12H2,1-2H3 |
| InChIKey | HYIVJDNCJWHHEH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|