C8H12BrNO3S — CID 83084663
1-bromo-N-[1-(5-methylfuran-2-yl)ethyl]methanesulfonamide (PubChem CID 83084663) has the molecular formula C8H12BrNO3S and a molecular weight of 282.16 g/mol. Its IUPAC name is 1-bromo-N-[1-(5-methylfuran-2-yl)ethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[1-(5-methylfuran-2-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 83084663 |
| Molecular Formula | C8H12BrNO3S |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 1-bromo-N-[1-(5-methylfuran-2-yl)ethyl]methanesulfonamide |
| SMILES | Cc1ccc(C(C)NS(=O)(=O)CBr)o1 |
| InChI | InChI=1S/C8H12BrNO3S/c1-6-3-4-8(13-6)7(2)10-14(11,12)5-9/h3-4,7,10H,5H2,1-2H3 |
| InChIKey | RNOASNLHEKLPQU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|