C11H12ClNO3S2 — CID 29355029
5-chloro-N-[(1S)-1-(5-methylfuran-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 29355029) has the molecular formula C11H12ClNO3S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 5-chloro-N-[(1S)-1-(5-methylfuran-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(1S)-1-(5-methylfuran-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 29355029 |
| Molecular Formula | C11H12ClNO3S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 5-chloro-N-[(1S)-1-(5-methylfuran-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc([C@H](C)NS(=O)(=O)c2ccc(Cl)s2)o1 |
| InChI | InChI=1S/C11H12ClNO3S2/c1-7-3-4-9(16-7)8(2)13-18(14,15)11-6-5-10(12)17-11/h3-6,8,13H,1-2H3/t8-/m0/s1 |
| InChIKey | OEJWPGKCVNCXIA-QMMMGPOBSA-N |
| XLogP | 3.34 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |