C16H20ClNO2S2 — CID 22772327
N-[1-(4-tert-butylphenyl)ethyl]-5-chlorothiophene-2-sulfonamide (PubChem CID 22772327) has the molecular formula C16H20ClNO2S2 and a molecular weight of 357.93 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22772327 |
| Molecular Formula | C16H20ClNO2S2 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-5-chlorothiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(Cl)s1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H20ClNO2S2/c1-11(12-5-7-13(8-6-12)16(2,3)4)18-22(19,20)15-10-9-14(17)21-15/h5-11,18H,1-4H3 |
| InChIKey | UQGOHEVXXYXOTD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |