C18H21F2NO2S — CID 22772322
N-[1-(4-tert-butylphenyl)ethyl]-2,4-difluorobenzenesulfonamide (PubChem CID 22772322) has the molecular formula C18H21F2NO2S and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22772322 |
| Molecular Formula | C18H21F2NO2S |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(F)cc1F)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H21F2NO2S/c1-12(13-5-7-14(8-6-13)18(2,3)4)21-24(22,23)17-10-9-15(19)11-16(17)20/h5-12,21H,1-4H3 |
| InChIKey | RIPAPGNRCZBWFM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |