C20H27NO4S — CID 22772320
N-[1-(4-tert-butylphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 22772320) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22772320 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)c2ccc(C(C)(C)C)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H27NO4S/c1-14(15-7-9-16(10-8-15)20(2,3)4)21-26(22,23)19-12-11-17(24-5)13-18(19)25-6/h7-14,21H,1-6H3 |
| InChIKey | OHZFMNRUEGAWFJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |