C15H18N2O4S — CID 40790424
2,4-dimethoxy-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide (PubChem CID 40790424) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40790424 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2,4-dimethoxy-N-[(1S)-1-pyridin-4-ylethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)c2ccncc2)c(OC)c1 |
| InChI | InChI=1S/C15H18N2O4S/c1-11(12-6-8-16-9-7-12)17-22(18,19)15-5-4-13(20-2)10-14(15)21-3/h4-11,17H,1-3H3/t11-/m0/s1 |
| InChIKey | APMGWPVMVSWBBM-NSHDSACASA-N |
| XLogP | 2.14 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |