C17H21NO5S — CID 3852201
2,5-dimethoxy-N-[1-(4-methoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 3852201) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[1-(4-methoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[1-(4-methoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3852201 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2,5-dimethoxy-N-[1-(4-methoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C17H21NO5S/c1-12(13-5-7-14(21-2)8-6-13)18-24(19,20)17-11-15(22-3)9-10-16(17)23-4/h5-12,18H,1-4H3 |
| InChIKey | NDVZZFQPTAJSNM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |