C19H25NO4S — CID 22204679
2,5-dimethoxy-N-[1-(4-propylphenyl)ethyl]benzenesulfonamide (PubChem CID 22204679) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[1-(4-propylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[1-(4-propylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22204679 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2,5-dimethoxy-N-[1-(4-propylphenyl)ethyl]benzenesulfonamide |
| SMILES | CCCc1ccc(C(C)NS(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C19H25NO4S/c1-5-6-15-7-9-16(10-8-15)14(2)20-25(21,22)19-13-17(23-3)11-12-18(19)24-4/h7-14,20H,5-6H2,1-4H3 |
| InChIKey | LSKOPJZHDTYVGW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |