C18H23NO6S — CID 22201254
N-[1-(3,4-dimethoxyphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 22201254) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22201254 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)c2ccc(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C18H23NO6S/c1-12(13-6-8-15(23-3)16(10-13)24-4)19-26(20,21)18-9-7-14(22-2)11-17(18)25-5/h6-12,19H,1-5H3 |
| InChIKey | ZIFKTQYFTWPVOQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |