C21H29NO4S — CID 22201208
N-[1-(4-butan-2-ylphenyl)propyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 22201208) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is N-[1-(4-butan-2-ylphenyl)propyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[1-(4-butan-2-ylphenyl)propyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22201208 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-[1-(4-butan-2-ylphenyl)propyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | CCC(C)c1ccc(C(CC)NS(=O)(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C21H29NO4S/c1-6-15(3)16-8-10-17(11-9-16)19(7-2)22-27(23,24)21-13-12-18(25-4)14-20(21)26-5/h8-15,19,22H,6-7H2,1-5H3 |
| InChIKey | HAHABSUWFHMYHD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |