C13H21NO3S — CID 110758402
2-methoxy-N,4-di(propan-2-yl)benzenesulfonamide (PubChem CID 110758402) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-methoxy-N,4-di(propan-2-yl)benzenesulfonamide.
| Compound Name | 2-methoxy-N,4-di(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110758402 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-methoxy-N,4-di(propan-2-yl)benzenesulfonamide |
| SMILES | COc1cc(C(C)C)ccc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C13H21NO3S/c1-9(2)11-6-7-13(12(8-11)17-5)18(15,16)14-10(3)4/h6-10,14H,1-5H3 |
| InChIKey | VHVFYNJFYDCVMK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |