C13H20N2O5S — CID 9264822
(2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethylpropanamide (PubChem CID 9264822) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is (2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethylpropanamide.
| Compound Name | (2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 9264822 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2R)-2-[(2,5-dimethoxyphenyl)sulfonylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@@H](C)NS(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H20N2O5S/c1-5-14-13(16)9(2)15-21(17,18)12-8-10(19-3)6-7-11(12)20-4/h6-9,15H,5H2,1-4H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | GBCWZHNKNNVIGB-SECBINFHSA-N |
| XLogP | 0.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |