C12H17NO7S — CID 61244972
2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-hydroxybutanoic acid (PubChem CID 61244972) has the molecular formula C12H17NO7S and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61244972 |
| Molecular Formula | C12H17NO7S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonylamino]-4-hydroxybutanoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC(CCO)C(=O)O)c1 |
| InChI | InChI=1S/C12H17NO7S/c1-19-8-3-4-10(20-2)11(7-8)21(17,18)13-9(5-6-14)12(15)16/h3-4,7,9,13-14H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | HRMAKTWNYUQCJT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |