C13H19NO7S2 — CID 120820494
2-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]pentanoic acid (PubChem CID 120820494) has the molecular formula C13H19NO7S2 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]pentanoic acid.
| Compound Name | 2-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 120820494 |
| Molecular Formula | C13H19NO7S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]pentanoic acid |
| SMILES | CCCC(NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1OC)C(=O)O |
| InChI | InChI=1S/C13H19NO7S2/c1-4-5-10(13(15)16)14-23(19,20)12-8-9(22(3,17)18)6-7-11(12)21-2/h6-8,10,14H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | IYSNGSKPDYRKKQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |