C11H15NO7S2 — CID 120820491
3-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]propanoic acid (PubChem CID 120820491) has the molecular formula C11H15NO7S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 120820491 |
| Molecular Formula | C11H15NO7S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 3-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]propanoic acid |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NCCC(=O)O |
| InChI | InChI=1S/C11H15NO7S2/c1-19-9-4-3-8(20(2,15)16)7-10(9)21(17,18)12-6-5-11(13)14/h3-4,7,12H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | MWKPPRMUQSXEOZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |