C13H19NO6S — CID 122067616
4-[[2-methoxy-5-(methoxymethyl)phenyl]sulfonylamino]butanoic acid (PubChem CID 122067616) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is 4-[[2-methoxy-5-(methoxymethyl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-[[2-methoxy-5-(methoxymethyl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 122067616 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-[[2-methoxy-5-(methoxymethyl)phenyl]sulfonylamino]butanoic acid |
| SMILES | COCc1ccc(OC)c(S(=O)(=O)NCCCC(=O)O)c1 |
| InChI | InChI=1S/C13H19NO6S/c1-19-9-10-5-6-11(20-2)12(8-10)21(17,18)14-7-3-4-13(15)16/h5-6,8,14H,3-4,7,9H2,1-2H3,(H,15,16) |
| InChIKey | FSEGZXBRRJDZAW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|