C14H22N2O6S2 — CID 110356844
N-[4-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]butyl]acetamide (PubChem CID 110356844) has the molecular formula C14H22N2O6S2 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[4-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]butyl]acetamide.
| Compound Name | N-[4-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]butyl]acetamide |
|---|---|
| PubChem CID | 110356844 |
| Molecular Formula | C14H22N2O6S2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[4-[(2-methoxy-5-methylsulfonylphenyl)sulfonylamino]butyl]acetamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NCCCCNC(C)=O |
| InChI | InChI=1S/C14H22N2O6S2/c1-11(17)15-8-4-5-9-16-24(20,21)14-10-12(23(3,18)19)6-7-13(14)22-2/h6-7,10,16H,4-5,8-9H2,1-3H3,(H,15,17) |
| InChIKey | FLOBSFJJNRTBHP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|