C11H17N3O5S2 — CID 62146789
N-[2-[(2-amino-5-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 62146789) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[2-[(2-amino-5-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(2-amino-5-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 62146789 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[2-[(2-amino-5-methylsulfonylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1N |
| InChI | InChI=1S/C11H17N3O5S2/c1-8(15)13-5-6-14-21(18,19)11-7-9(20(2,16)17)3-4-10(11)12/h3-4,7,14H,5-6,12H2,1-2H3,(H,13,15) |
| InChIKey | MHQCESLMKNZMMT-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|