C10H12F2N2O3S — CID 26942986
N-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]acetamide (PubChem CID 26942986) has the molecular formula C10H12F2N2O3S and a molecular weight of 278.28 g/mol. Its IUPAC name is N-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 26942986 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-[2-[(3,4-difluorophenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2O3S/c1-7(15)13-4-5-14-18(16,17)8-2-3-9(11)10(12)6-8/h2-3,6,14H,4-5H2,1H3,(H,13,15) |
| InChIKey | UYCLPJDVXRFLBB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|