C11H16F2N2O2S — CID 62663879
3,4-difluoro-N-[2-(propylamino)ethyl]benzenesulfonamide (PubChem CID 62663879) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-(propylamino)ethyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[2-(propylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62663879 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3,4-difluoro-N-[2-(propylamino)ethyl]benzenesulfonamide |
| SMILES | CCCNCCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H16F2N2O2S/c1-2-5-14-6-7-15-18(16,17)9-3-4-10(12)11(13)8-9/h3-4,8,14-15H,2,5-7H2,1H3 |
| InChIKey | MKWUTZSGJMLUFZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|