C12H20ClFN2O4S2 — CID 120716059
3-fluoro-4-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120716059) has the molecular formula C12H20ClFN2O4S2 and a molecular weight of 374.89 g/mol. Its IUPAC name is 3-fluoro-4-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 3-fluoro-4-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120716059 |
| Molecular Formula | C12H20ClFN2O4S2 |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 3-fluoro-4-methylsulfonyl-N-[2-(propylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCCNCCNS(=O)(=O)c1ccc(S(C)(=O)=O)c(F)c1.Cl |
| InChI | InChI=1S/C12H19FN2O4S2.ClH/c1-3-6-14-7-8-15-21(18,19)10-4-5-12(11(13)9-10)20(2,16)17;/h4-5,9,14-15H,3,6-8H2,1-2H3;1H |
| InChIKey | IETIFLGZLZWXIU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|