C11H17FN2O4S2 — CID 119972350
N-(3-aminobutyl)-3-fluoro-4-methylsulfonylbenzenesulfonamide (PubChem CID 119972350) has the molecular formula C11H17FN2O4S2 and a molecular weight of 324.40 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-fluoro-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-3-fluoro-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 119972350 |
| Molecular Formula | C11H17FN2O4S2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-(3-aminobutyl)-3-fluoro-4-methylsulfonylbenzenesulfonamide |
| SMILES | CC(N)CCNS(=O)(=O)c1ccc(S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C11H17FN2O4S2/c1-8(13)5-6-14-20(17,18)9-3-4-11(10(12)7-9)19(2,15)16/h3-4,7-8,14H,5-6,13H2,1-2H3 |
| InChIKey | LHNCWDXYDPLXHH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |