C11H17ClN2O4S2 — CID 63251758
N-(3-aminobutyl)-2-chloro-5-methylsulfonylbenzenesulfonamide (PubChem CID 63251758) has the molecular formula C11H17ClN2O4S2 and a molecular weight of 340.85 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-chloro-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-2-chloro-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 63251758 |
| Molecular Formula | C11H17ClN2O4S2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | N-(3-aminobutyl)-2-chloro-5-methylsulfonylbenzenesulfonamide |
| SMILES | CC(N)CCNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C11H17ClN2O4S2/c1-8(13)5-6-14-20(17,18)11-7-9(19(2,15)16)3-4-10(11)12/h3-4,7-8,14H,5-6,13H2,1-2H3 |
| InChIKey | SSAUOPNKCICYGA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |