C14H22ClNO4S2 — CID 35295404
2-chloro-N-[(2S)-5-methylhexan-2-yl]-5-methylsulfonylbenzenesulfonamide (PubChem CID 35295404) has the molecular formula C14H22ClNO4S2 and a molecular weight of 367.92 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-5-methylhexan-2-yl]-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-chloro-N-[(2S)-5-methylhexan-2-yl]-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 35295404 |
| Molecular Formula | C14H22ClNO4S2 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-chloro-N-[(2S)-5-methylhexan-2-yl]-5-methylsulfonylbenzenesulfonamide |
| SMILES | CC(C)CC[C@H](C)NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C14H22ClNO4S2/c1-10(2)5-6-11(3)16-22(19,20)14-9-12(21(4,17)18)7-8-13(14)15/h7-11,16H,5-6H2,1-4H3/t11-/m0/s1 |
| InChIKey | SOKXMLXQXXGNLU-NSHDSACASA-N |
| XLogP | 2.85 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |