C12H18FNO4S2 — CID 43454734
2-fluoro-5-methylsulfonyl-N-pentan-2-ylbenzenesulfonamide (PubChem CID 43454734) has the molecular formula C12H18FNO4S2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-fluoro-5-methylsulfonyl-N-pentan-2-ylbenzenesulfonamide.
| Compound Name | 2-fluoro-5-methylsulfonyl-N-pentan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 43454734 |
| Molecular Formula | C12H18FNO4S2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-fluoro-5-methylsulfonyl-N-pentan-2-ylbenzenesulfonamide |
| SMILES | CCCC(C)NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H18FNO4S2/c1-4-5-9(2)14-20(17,18)12-8-10(19(3,15)16)6-7-11(12)13/h6-9,14H,4-5H2,1-3H3 |
| InChIKey | GYYDYOMEEIHFQS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |