C10H12FNO7S2 — CID 80755904
(2R)-2-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]-3-hydroxypropanoic acid (PubChem CID 80755904) has the molecular formula C10H12FNO7S2 and a molecular weight of 341.34 g/mol. Its IUPAC name is (2R)-2-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80755904 |
| Molecular Formula | C10H12FNO7S2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | (2R)-2-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]-3-hydroxypropanoic acid |
| SMILES | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)N[C@H](CO)C(=O)O)c1 |
| InChI | InChI=1S/C10H12FNO7S2/c1-20(16,17)6-2-3-7(11)9(4-6)21(18,19)12-8(5-13)10(14)15/h2-4,8,12-13H,5H2,1H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | ZYGFHNYPQXYQDZ-MRVPVSSYSA-N |
| XLogP | -1.05 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |