C11H14FNO6S2 — CID 43455216
3-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid (PubChem CID 43455216) has the molecular formula C11H14FNO6S2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid.
| Compound Name | 3-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43455216 |
| Molecular Formula | C11H14FNO6S2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-[(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C11H14FNO6S2/c1-7(5-11(14)15)13-21(18,19)10-6-8(20(2,16)17)3-4-9(10)12/h3-4,6-7,13H,5H2,1-2H3,(H,14,15) |
| InChIKey | YRDITAUUPDFVIK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |