C13H16FNO5S — CID 62964722
5-(2-fluoro-5-methylsulfonylanilino)-3-methyl-5-oxopentanoic acid (PubChem CID 62964722) has the molecular formula C13H16FNO5S and a molecular weight of 317.34 g/mol. Its IUPAC name is 5-(2-fluoro-5-methylsulfonylanilino)-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-(2-fluoro-5-methylsulfonylanilino)-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62964722 |
| Molecular Formula | C13H16FNO5S |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-(2-fluoro-5-methylsulfonylanilino)-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)Nc1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C13H16FNO5S/c1-8(6-13(17)18)5-12(16)15-11-7-9(21(2,19)20)3-4-10(11)14/h3-4,7-8H,5-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | YWFQBZVINHKFEG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |