C12H14FNO5S — CID 60708181
5-(2-fluoro-5-methylsulfonylanilino)-5-oxopentanoic acid (PubChem CID 60708181) has the molecular formula C12H14FNO5S and a molecular weight of 303.31 g/mol. Its IUPAC name is 5-(2-fluoro-5-methylsulfonylanilino)-5-oxopentanoic acid.
| Compound Name | 5-(2-fluoro-5-methylsulfonylanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 60708181 |
| Molecular Formula | C12H14FNO5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-(2-fluoro-5-methylsulfonylanilino)-5-oxopentanoic acid |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)CCCC(=O)O)c1 |
| InChI | InChI=1S/C12H14FNO5S/c1-20(18,19)8-5-6-9(13)10(7-8)14-11(15)3-2-4-12(16)17/h5-7H,2-4H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | WRDIGDAQGTXFFB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |