C16H17FN2O5S — CID 31931206
N-[4-(2-fluoro-5-methylsulfonylanilino)-4-oxobutyl]furan-2-carboxamide (PubChem CID 31931206) has the molecular formula C16H17FN2O5S and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[4-(2-fluoro-5-methylsulfonylanilino)-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-(2-fluoro-5-methylsulfonylanilino)-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31931206 |
| Molecular Formula | C16H17FN2O5S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[4-(2-fluoro-5-methylsulfonylanilino)-4-oxobutyl]furan-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)CCCNC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C16H17FN2O5S/c1-25(22,23)11-6-7-12(17)13(10-11)19-15(20)5-2-8-18-16(21)14-4-3-9-24-14/h3-4,6-7,9-10H,2,5,8H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | CUVPKQOTVJHNDM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|